C16H20BrClN2S — CID 63816363
2-(2-aminobutyl)-N-[(5-bromothiophen-3-yl)methyl]-3-chloro-N-methylaniline (PubChem CID 63816363) has the molecular formula C16H20BrClN2S and a molecular weight of 387.77 g/mol. Its IUPAC name is 2-(2-aminobutyl)-N-[(5-bromothiophen-3-yl)methyl]-3-chloro-N-methylaniline.
| Compound Name | 2-(2-aminobutyl)-N-[(5-bromothiophen-3-yl)methyl]-3-chloro-N-methylaniline |
|---|---|
| PubChem CID | 63816363 |
| Molecular Formula | C16H20BrClN2S |
| Molecular Weight | 387.77 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 2-(2-aminobutyl)-N-[(5-bromothiophen-3-yl)methyl]-3-chloro-N-methylaniline |
| SMILES | CCC(N)Cc1c(Cl)cccc1N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C16H20BrClN2S/c1-3-12(19)8-13-14(18)5-4-6-15(13)20(2)9-11-7-16(17)21-10-11/h4-7,10,12H,3,8-9,19H2,1-2H3 |
| InChIKey | SPCPYKGSQCQCGP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.77 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |