C15H14F3NO2 — CID 63594228
2-(3,5-difluorophenoxy)-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 63594228) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-(3,5-difluorophenoxy)-5-fluoro-4-propan-2-yloxyaniline.
| Compound Name | 2-(3,5-difluorophenoxy)-5-fluoro-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 63594228 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(3,5-difluorophenoxy)-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | CC(C)Oc1cc(Oc2cc(F)cc(F)c2)c(N)cc1F |
| InChI | InChI=1S/C15H14F3NO2/c1-8(2)20-14-7-15(13(19)6-12(14)18)21-11-4-9(16)3-10(17)5-11/h3-8H,19H2,1-2H3 |
| InChIKey | STGPFPQKZCZFPF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|