C14H24FN3O — CID 55217444
1-N-[2-(dimethylamino)propyl]-4-fluoro-5-propan-2-yloxybenzene-1,2-diamine (PubChem CID 55217444) has the molecular formula C14H24FN3O and a molecular weight of 269.36 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)propyl]-4-fluoro-5-propan-2-yloxybenzene-1,2-diamine.
| Compound Name | 1-N-[2-(dimethylamino)propyl]-4-fluoro-5-propan-2-yloxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 55217444 |
| Molecular Formula | C14H24FN3O |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1-N-[2-(dimethylamino)propyl]-4-fluoro-5-propan-2-yloxybenzene-1,2-diamine |
| SMILES | CC(C)Oc1cc(NCC(C)N(C)C)c(N)cc1F |
| InChI | InChI=1S/C14H24FN3O/c1-9(2)19-14-7-13(12(16)6-11(14)15)17-8-10(3)18(4)5/h6-7,9-10,17H,8,16H2,1-5H3 |
| InChIKey | IUBWLNMDQVBUOE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|