C13H22FN3O3S — CID 106334507
2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)-N,N-dimethylethanesulfonamide (PubChem CID 106334507) has the molecular formula C13H22FN3O3S and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)-N,N-dimethylethanesulfonamide.
| Compound Name | 2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)-N,N-dimethylethanesulfonamide |
|---|---|
| PubChem CID | 106334507 |
| Molecular Formula | C13H22FN3O3S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-(2-amino-4-fluoro-5-propan-2-yloxyanilino)-N,N-dimethylethanesulfonamide |
| SMILES | CC(C)Oc1cc(NCCS(=O)(=O)N(C)C)c(N)cc1F |
| InChI | InChI=1S/C13H22FN3O3S/c1-9(2)20-13-8-12(11(15)7-10(13)14)16-5-6-21(18,19)17(3)4/h7-9,16H,5-6,15H2,1-4H3 |
| InChIKey | JQMIPZKMOCTKSU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|