C12H16FN5O — CID 64545724
4-fluoro-5-propan-2-yloxy-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,2-diamine (PubChem CID 64545724) has the molecular formula C12H16FN5O and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-fluoro-5-propan-2-yloxy-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-propan-2-yloxy-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 64545724 |
| Molecular Formula | C12H16FN5O |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-fluoro-5-propan-2-yloxy-1-N-(1H-1,2,4-triazol-5-ylmethyl)benzene-1,2-diamine |
| SMILES | CC(C)Oc1cc(NCc2ncn[nH]2)c(N)cc1F |
| InChI | InChI=1S/C12H16FN5O/c1-7(2)19-11-4-10(9(14)3-8(11)13)15-5-12-16-6-17-18-12/h3-4,6-7,15H,5,14H2,1-2H3,(H,16,17,18) |
| InChIKey | LBTOVGFGRXJGHK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|