C14H18FN3OS — CID 63592421
4-fluoro-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-propan-2-yloxybenzene-1,2-diamine (PubChem CID 63592421) has the molecular formula C14H18FN3OS and a molecular weight of 295.38 g/mol. Its IUPAC name is 4-fluoro-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-propan-2-yloxybenzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-propan-2-yloxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 63592421 |
| Molecular Formula | C14H18FN3OS |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-fluoro-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-propan-2-yloxybenzene-1,2-diamine |
| SMILES | Cc1nc(CNc2cc(OC(C)C)c(F)cc2N)cs1 |
| InChI | InChI=1S/C14H18FN3OS/c1-8(2)19-14-5-13(12(16)4-11(14)15)17-6-10-7-20-9(3)18-10/h4-5,7-8,17H,6,16H2,1-3H3 |
| InChIKey | RFMFBBRFPJXMIM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|