C13H16FN3OS — CID 106035876
4-fluoro-5-methoxy-1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzene-1,2-diamine (PubChem CID 106035876) has the molecular formula C13H16FN3OS and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-fluoro-5-methoxy-1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methoxy-1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 106035876 |
| Molecular Formula | C13H16FN3OS |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-fluoro-5-methoxy-1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]benzene-1,2-diamine |
| SMILES | COc1cc(NCCc2csc(C)n2)c(N)cc1F |
| InChI | InChI=1S/C13H16FN3OS/c1-8-17-9(7-19-8)3-4-16-12-6-13(18-2)10(14)5-11(12)15/h5-7,16H,3-4,15H2,1-2H3 |
| InChIKey | RMIKXBSHJJUKFJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|