C13H14F3N3S — CID 106036005
1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 106036005) has the molecular formula C13H14F3N3S and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106036005 |
| Molecular Formula | C13H14F3N3S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Cc1nc(CCNc2ccc(N)cc2C(F)(F)F)cs1 |
| InChI | InChI=1S/C13H14F3N3S/c1-8-19-10(7-20-8)4-5-18-12-3-2-9(17)6-11(12)13(14,15)16/h2-3,6-7,18H,4-5,17H2,1H3 |
| InChIKey | OQSCDFRCFDEIOI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|