C13H14N4S — CID 114139204
5-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzonitrile (PubChem CID 114139204) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 5-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzonitrile.
| Compound Name | 5-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 114139204 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzonitrile |
| SMILES | Cc1nc(CCNc2ccc(N)cc2C#N)cs1 |
| InChI | InChI=1S/C13H14N4S/c1-9-17-12(8-18-9)4-5-16-13-3-2-11(15)6-10(13)7-14/h2-3,6,8,16H,4-5,15H2,1H3 |
| InChIKey | CKIABGFJAIIODP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|