C14H18N4OS — CID 106036023
4-amino-N-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzamide (PubChem CID 106036023) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-amino-N-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzamide.
| Compound Name | 4-amino-N-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 106036023 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-amino-N-methyl-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzamide |
| SMILES | CNC(=O)c1ccc(N)cc1NCCc1csc(C)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-9-18-11(8-20-9)5-6-17-13-7-10(15)3-4-12(13)14(19)16-2/h3-4,7-8,17H,5-6,15H2,1-2H3,(H,16,19) |
| InChIKey | QOGYIWRZPBDZIH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|