C13H15N3O2S — CID 106039434
4-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzoic acid (PubChem CID 106039434) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzoic acid.
| Compound Name | 4-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106039434 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-amino-2-[2-(2-methyl-1,3-thiazol-4-yl)ethylamino]benzoic acid |
| SMILES | Cc1nc(CCNc2cc(N)ccc2C(=O)O)cs1 |
| InChI | InChI=1S/C13H15N3O2S/c1-8-16-10(7-19-8)4-5-15-12-6-9(14)2-3-11(12)13(17)18/h2-3,6-7,15H,4-5,14H2,1H3,(H,17,18) |
| InChIKey | AZQHHEWPVRPENH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|