C15H16N4S — CID 106035847
5-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]quinoline-5,8-diamine (PubChem CID 106035847) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 5-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]quinoline-5,8-diamine.
| Compound Name | 5-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]quinoline-5,8-diamine |
|---|---|
| PubChem CID | 106035847 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]quinoline-5,8-diamine |
| SMILES | Cc1nc(CCNc2ccc(N)c3ncccc23)cs1 |
| InChI | InChI=1S/C15H16N4S/c1-10-19-11(9-20-10)6-8-17-14-5-4-13(16)15-12(14)3-2-7-18-15/h2-5,7,9,17H,6,8,16H2,1H3 |
| InChIKey | FOBBHAPSEAMULR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|