C12H10F3N3OS — CID 65199742
N-[4-amino-2-(trifluoromethyl)phenyl]-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 65199742) has the molecular formula C12H10F3N3OS and a molecular weight of 301.29 g/mol. Its IUPAC name is N-[4-amino-2-(trifluoromethyl)phenyl]-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-amino-2-(trifluoromethyl)phenyl]-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65199742 |
| Molecular Formula | C12H10F3N3OS |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-[4-amino-2-(trifluoromethyl)phenyl]-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(N)cc2C(F)(F)F)cs1 |
| InChI | InChI=1S/C12H10F3N3OS/c1-6-17-10(5-20-6)11(19)18-9-3-2-7(16)4-8(9)12(13,14)15/h2-5H,16H2,1H3,(H,18,19) |
| InChIKey | QIXRMYYFEDPUHS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|