C12H10ClN3OS2 — CID 107808615
N-(4-carbamothioyl-2-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 107808615) has the molecular formula C12H10ClN3OS2 and a molecular weight of 311.82 g/mol. Its IUPAC name is N-(4-carbamothioyl-2-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-carbamothioyl-2-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 107808615 |
| Molecular Formula | C12H10ClN3OS2 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | N-(4-carbamothioyl-2-chlorophenyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2ccc(C(N)=S)cc2Cl)cs1 |
| InChI | InChI=1S/C12H10ClN3OS2/c1-6-15-10(5-19-6)12(17)16-9-3-2-7(11(14)18)4-8(9)13/h2-5H,1H3,(H2,14,18)(H,16,17) |
| InChIKey | MLXYJAGITWPHBC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|