C8H8ClN3OS — CID 107808654
(4-carbamothioyl-2-chlorophenyl)urea (PubChem CID 107808654) has the molecular formula C8H8ClN3OS and a molecular weight of 229.69 g/mol. Its IUPAC name is (4-carbamothioyl-2-chlorophenyl)urea.
| Compound Name | (4-carbamothioyl-2-chlorophenyl)urea |
|---|---|
| PubChem CID | 107808654 |
| Molecular Formula | C8H8ClN3OS |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | (4-carbamothioyl-2-chlorophenyl)urea |
| SMILES | NC(=O)Nc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C8H8ClN3OS/c9-5-3-4(7(10)14)1-2-6(5)12-8(11)13/h1-3H,(H2,10,14)(H3,11,12,13) |
| InChIKey | ZXAKPSNQLOIHCJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|