C12H16ClN3OS — CID 107808646
1-butyl-3-(4-carbamothioyl-2-chlorophenyl)urea (PubChem CID 107808646) has the molecular formula C12H16ClN3OS and a molecular weight of 285.80 g/mol. Its IUPAC name is 1-butyl-3-(4-carbamothioyl-2-chlorophenyl)urea.
| Compound Name | 1-butyl-3-(4-carbamothioyl-2-chlorophenyl)urea |
|---|---|
| PubChem CID | 107808646 |
| Molecular Formula | C12H16ClN3OS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-butyl-3-(4-carbamothioyl-2-chlorophenyl)urea |
| SMILES | CCCCNC(=O)Nc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C12H16ClN3OS/c1-2-3-6-15-12(17)16-10-5-4-8(11(14)18)7-9(10)13/h4-5,7H,2-3,6H2,1H3,(H2,14,18)(H2,15,16,17) |
| InChIKey | BJLUVLSITSLLJB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|