C14H21N5O3 — CID 166386334
1-butyl-3-[5-[(carbamoylamino)carbamoyl]-2-methylphenyl]urea (PubChem CID 166386334) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 1-butyl-3-[5-[(carbamoylamino)carbamoyl]-2-methylphenyl]urea.
| Compound Name | 1-butyl-3-[5-[(carbamoylamino)carbamoyl]-2-methylphenyl]urea |
|---|---|
| PubChem CID | 166386334 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-butyl-3-[5-[(carbamoylamino)carbamoyl]-2-methylphenyl]urea |
| SMILES | CCCCNC(=O)Nc1cc(C(=O)NNC(N)=O)ccc1C |
| InChI | InChI=1S/C14H21N5O3/c1-3-4-7-16-14(22)17-11-8-10(6-5-9(11)2)12(20)18-19-13(15)21/h5-6,8H,3-4,7H2,1-2H3,(H,18,20)(H3,15,19,21)(H2,16,17,22) |
| InChIKey | YACMWHYMOKMLBB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|