C13H20N2O — CID 162213335
N'-butyl-3,4-dimethylbenzohydrazide (PubChem CID 162213335) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N'-butyl-3,4-dimethylbenzohydrazide.
| Compound Name | N'-butyl-3,4-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 162213335 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N'-butyl-3,4-dimethylbenzohydrazide |
| SMILES | CCCCNNC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H20N2O/c1-4-5-8-14-15-13(16)12-7-6-10(2)11(3)9-12/h6-7,9,14H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | ZTDMWQYLKJYWOG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|