C15H22N2O2 — CID 108574738
N-[2-(butanoylamino)ethyl]-3,4-dimethylbenzamide (PubChem CID 108574738) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[2-(butanoylamino)ethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-(butanoylamino)ethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 108574738 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[2-(butanoylamino)ethyl]-3,4-dimethylbenzamide |
| SMILES | CCCC(=O)NCCNC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-4-5-14(18)16-8-9-17-15(19)13-7-6-11(2)12(3)10-13/h6-7,10H,4-5,8-9H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | FFQXZPCERGZPEZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|