C18H28N2O3 — CID 27682949
N-[2-(3-butoxypropylamino)-2-oxoethyl]-3,4-dimethylbenzamide (PubChem CID 27682949) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[2-(3-butoxypropylamino)-2-oxoethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-(3-butoxypropylamino)-2-oxoethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 27682949 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | N-[2-(3-butoxypropylamino)-2-oxoethyl]-3,4-dimethylbenzamide |
| SMILES | CCCCOCCCNC(=O)CNC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H28N2O3/c1-4-5-10-23-11-6-9-19-17(21)13-20-18(22)16-8-7-14(2)15(3)12-16/h7-8,12H,4-6,9-11,13H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | YJBJUJHRJOBKMF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|