C16H22N2O4 — CID 120534617
2-[[2-[(3,4-dimethylbenzoyl)amino]acetyl]amino]pentanoic acid (PubChem CID 120534617) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[[2-[(3,4-dimethylbenzoyl)amino]acetyl]amino]pentanoic acid.
| Compound Name | 2-[[2-[(3,4-dimethylbenzoyl)amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120534617 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 2-[[2-[(3,4-dimethylbenzoyl)amino]acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)CNC(=O)c1ccc(C)c(C)c1)C(=O)O |
| InChI | InChI=1S/C16H22N2O4/c1-4-5-13(16(21)22)18-14(19)9-17-15(20)12-7-6-10(2)11(3)8-12/h6-8,13H,4-5,9H2,1-3H3,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | FBFPIJPTBMLTCF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |