C26H28N2O2 — CID 46432021
N-[2-(1,1-diphenylpropan-2-ylamino)-2-oxoethyl]-3,4-dimethylbenzamide (PubChem CID 46432021) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is N-[2-(1,1-diphenylpropan-2-ylamino)-2-oxoethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-(1,1-diphenylpropan-2-ylamino)-2-oxoethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 46432021 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N-[2-(1,1-diphenylpropan-2-ylamino)-2-oxoethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)NC(C)C(c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C26H28N2O2/c1-18-14-15-23(16-19(18)2)26(30)27-17-24(29)28-20(3)25(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-16,20,25H,17H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | DMQNWSNTAOADQI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |