C20H31N3O4 — CID 108921652
tert-butyl N-[3-[3-[(3,4-dimethylbenzoyl)amino]propylamino]-3-oxopropyl]carbamate (PubChem CID 108921652) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[(3,4-dimethylbenzoyl)amino]propylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[(3,4-dimethylbenzoyl)amino]propylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108921652 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | tert-butyl N-[3-[3-[(3,4-dimethylbenzoyl)amino]propylamino]-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(C(=O)NCCCNC(=O)CCNC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C20H31N3O4/c1-14-7-8-16(13-15(14)2)18(25)22-11-6-10-21-17(24)9-12-23-19(26)27-20(3,4)5/h7-8,13H,6,9-12H2,1-5H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | OURVQBPYYURFRO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|