C20H31N3O5 — CID 108919087
tert-butyl N-[3-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethylamino]-3-oxopropyl]carbamate (PubChem CID 108919087) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108919087 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | tert-butyl N-[3-[2-[[2-(3,4-dimethylphenoxy)acetyl]amino]ethylamino]-3-oxopropyl]carbamate |
| SMILES | Cc1ccc(OCC(=O)NCCNC(=O)CCNC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C20H31N3O5/c1-14-6-7-16(12-15(14)2)27-13-18(25)22-11-10-21-17(24)8-9-23-19(26)28-20(3,4)5/h6-7,12H,8-11,13H2,1-5H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | MGGKDXCRIMCTHS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|