C21H33N3O5 — CID 108919090
tert-butyl N-[3-oxo-3-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethylamino]propyl]carbamate (PubChem CID 108919090) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108919090 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethylamino]propyl]carbamate |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCNC(=O)CCNC(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C21H33N3O5/c1-14-7-8-15(2)19(16(14)3)28-13-18(26)23-12-11-22-17(25)9-10-24-20(27)29-21(4,5)6/h7-8H,9-13H2,1-6H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | IVOWFDZLLSBJNB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|