C20H24N2O4 — CID 108572762
phenyl N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]carbamate (PubChem CID 108572762) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is phenyl N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]carbamate.
| Compound Name | phenyl N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108572762 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | phenyl N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]carbamate |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCNC(=O)Oc2ccccc2)c1C |
| InChI | InChI=1S/C20H24N2O4/c1-14-9-10-15(2)19(16(14)3)25-13-18(23)21-11-12-22-20(24)26-17-7-5-4-6-8-17/h4-10H,11-13H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | XVYJIDAIPKDQCJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|