C22H27ClN2O4 — CID 108541454
2-(4-chlorophenoxy)-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide (PubChem CID 108541454) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 108541454 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCNC(=O)C(C)Oc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C22H27ClN2O4/c1-14-5-6-15(2)21(16(14)3)28-13-20(26)24-11-12-25-22(27)17(4)29-19-9-7-18(23)8-10-19/h5-10,17H,11-13H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | RGCYZBWERJCVRV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|