C20H30N2O3 — CID 108538932
N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]cyclohexanecarboxamide (PubChem CID 108538932) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 108538932 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]cyclohexanecarboxamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCNC(=O)C2CCCCC2)c1C |
| InChI | InChI=1S/C20H30N2O3/c1-14-9-10-15(2)19(16(14)3)25-13-18(23)21-11-12-22-20(24)17-7-5-4-6-8-17/h9-10,17H,4-8,11-13H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | RYVHQJTXUKLBMY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|