C22H34N2O3 — CID 108541528
3-cyclohexyl-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide (PubChem CID 108541528) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 3-cyclohexyl-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 108541528 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 3-cyclohexyl-N-[2-[[2-(2,3,6-trimethylphenoxy)acetyl]amino]ethyl]propanamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCNC(=O)CCC2CCCCC2)c1C |
| InChI | InChI=1S/C22H34N2O3/c1-16-9-10-17(2)22(18(16)3)27-15-21(26)24-14-13-23-20(25)12-11-19-7-5-4-6-8-19/h9-10,19H,4-8,11-15H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | NQUMCXKMRSKJCI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|