C19H30N2O3S — CID 108573891
3-cyclohexyl-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]propanamide (PubChem CID 108573891) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is 3-cyclohexyl-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 108573891 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 3-cyclohexyl-N-[2-[(3,4-dimethylphenyl)sulfonylamino]ethyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)CCC2CCCCC2)cc1C |
| InChI | InChI=1S/C19H30N2O3S/c1-15-8-10-18(14-16(15)2)25(23,24)21-13-12-20-19(22)11-9-17-6-4-3-5-7-17/h8,10,14,17,21H,3-7,9,11-13H2,1-2H3,(H,20,22) |
| InChIKey | ZQXFGBFATISHNT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|