C23H30N2O4 — CID 55806512
N-[2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]ethyl]cyclohexanecarboxamide (PubChem CID 55806512) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is N-[2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55806512 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-[2-[[2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetyl]amino]ethyl]cyclohexanecarboxamide |
| SMILES | O=C(COc1ccc2oc3c(c2c1)CCCC3)NCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C23H30N2O4/c26-22(24-12-13-25-23(27)16-6-2-1-3-7-16)15-28-17-10-11-21-19(14-17)18-8-4-5-9-20(18)29-21/h10-11,14,16H,1-9,12-13,15H2,(H,24,26)(H,25,27) |
| InChIKey | WQPXGOWREZKWQB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|