C22H33N3O3+2 — CID 9049074
N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide (PubChem CID 9049074) has the molecular formula C22H33N3O3+2 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide.
| Compound Name | N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
|---|---|
| PubChem CID | 9049074 |
| Molecular Formula | C22H33N3O3+2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | N-[3-(4-methylpiperazine-1,4-diium-1-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
| SMILES | C[NH+]1CC[NH+](CCCNC(=O)COc2ccc3oc4c(c3c2)CCCC4)CC1 |
| InChI | InChI=1S/C22H31N3O3/c1-24-11-13-25(14-12-24)10-4-9-23-22(26)16-27-17-7-8-21-19(15-17)18-5-2-3-6-20(18)28-21/h7-8,15H,2-6,9-14,16H2,1H3,(H,23,26)/p+2 |
| InChIKey | NGDQSRIWDMSKCW-UHFFFAOYSA-P |
| XLogP | -0.39 |
| TPSA | 60.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|