C21H23N5O3 — CID 8840553
N-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide (PubChem CID 8840553) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide.
| Compound Name | N-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
|---|---|
| PubChem CID | 8840553 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[3-(3-amino-4-cyano-1H-pyrazol-5-yl)propyl]-2-(6,7,8,9-tetrahydrodibenzofuran-2-yloxy)acetamide |
| SMILES | N#Cc1c(N)n[nH]c1CCCNC(=O)COc1ccc2oc3c(c2c1)CCCC3 |
| InChI | InChI=1S/C21H23N5O3/c22-11-16-17(25-26-21(16)23)5-3-9-24-20(27)12-28-13-7-8-19-15(10-13)14-4-1-2-6-18(14)29-19/h7-8,10H,1-6,9,12H2,(H,24,27)(H3,23,25,26) |
| InChIKey | ZNBLMJJJEKVLRJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|