C23H37N3O5 — CID 108921601
tert-butyl N-[3-[3-[4-(2,6-dimethylphenoxy)butanoylamino]propylamino]-3-oxopropyl]carbamate (PubChem CID 108921601) has the molecular formula C23H37N3O5 and a molecular weight of 435.57 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[4-(2,6-dimethylphenoxy)butanoylamino]propylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[4-(2,6-dimethylphenoxy)butanoylamino]propylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108921601 |
| Molecular Formula | C23H37N3O5 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | tert-butyl N-[3-[3-[4-(2,6-dimethylphenoxy)butanoylamino]propylamino]-3-oxopropyl]carbamate |
| SMILES | Cc1cccc(C)c1OCCCC(=O)NCCCNC(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37N3O5/c1-17-9-6-10-18(2)21(17)30-16-7-11-19(27)24-13-8-14-25-20(28)12-15-26-22(29)31-23(3,4)5/h6,9-10H,7-8,11-16H2,1-5H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | RKLSXTONIYSOBL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|