C16H23ClN2O3 — CID 108572936
N-[2-[(2-chloroacetyl)amino]ethyl]-4-(2,6-dimethylphenoxy)butanamide (PubChem CID 108572936) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is N-[2-[(2-chloroacetyl)amino]ethyl]-4-(2,6-dimethylphenoxy)butanamide.
| Compound Name | N-[2-[(2-chloroacetyl)amino]ethyl]-4-(2,6-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 108572936 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[2-[(2-chloroacetyl)amino]ethyl]-4-(2,6-dimethylphenoxy)butanamide |
| SMILES | Cc1cccc(C)c1OCCCC(=O)NCCNC(=O)CCl |
| InChI | InChI=1S/C16H23ClN2O3/c1-12-5-3-6-13(2)16(12)22-10-4-7-14(20)18-8-9-19-15(21)11-17/h3,5-6H,4,7-11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | UGGHRTCBOUBGDD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|