C21H28N2O5S — CID 108572911
4-(2,6-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]butanamide (PubChem CID 108572911) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]butanamide.
| Compound Name | 4-(2,6-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 108572911 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]butanamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)CCCOc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C21H28N2O5S/c1-16-6-4-7-17(2)21(16)28-15-5-8-20(24)22-13-14-23-29(25,26)19-11-9-18(27-3)10-12-19/h4,6-7,9-12,23H,5,8,13-15H2,1-3H3,(H,22,24) |
| InChIKey | LAQZWMWVXPIZSK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|