C24H37N3O5 — CID 108543127
tert-butyl N-[2-[4-[4-(2,6-dimethylphenoxy)butanoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate (PubChem CID 108543127) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-(2,6-dimethylphenoxy)butanoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-(2,6-dimethylphenoxy)butanoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108543127 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | tert-butyl N-[2-[4-[4-(2,6-dimethylphenoxy)butanoyl]-1,4-diazepan-1-yl]-2-oxoethyl]carbamate |
| SMILES | Cc1cccc(C)c1OCCCC(=O)N1CCCN(C(=O)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H37N3O5/c1-18-9-6-10-19(2)22(18)31-16-7-11-20(28)26-12-8-13-27(15-14-26)21(29)17-25-23(30)32-24(3,4)5/h6,9-10H,7-8,11-17H2,1-5H3,(H,25,30) |
| InChIKey | SIBWLDBOWFSRNW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|