C21H29BrClN3O5 — CID 108916045
tert-butyl N-[2-[4-[4-(4-bromo-2-chlorophenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate (PubChem CID 108916045) has the molecular formula C21H29BrClN3O5 and a molecular weight of 518.84 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-(4-bromo-2-chlorophenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-(4-bromo-2-chlorophenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108916045 |
| Molecular Formula | C21H29BrClN3O5 |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | tert-butyl N-[2-[4-[4-(4-bromo-2-chlorophenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)N1CCN(C(=O)CCCOc2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C21H29BrClN3O5/c1-21(2,3)31-20(29)24-14-19(28)26-10-8-25(9-11-26)18(27)5-4-12-30-17-7-6-15(22)13-16(17)23/h6-7,13H,4-5,8-12,14H2,1-3H3,(H,24,29) |
| InChIKey | CZMABVIBEKVGCN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|