C14H18BrClN2O4 — CID 108572953
methyl N-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]ethyl]carbamate (PubChem CID 108572953) has the molecular formula C14H18BrClN2O4 and a molecular weight of 393.67 g/mol. Its IUPAC name is methyl N-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]ethyl]carbamate.
| Compound Name | methyl N-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108572953 |
| Molecular Formula | C14H18BrClN2O4 |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | methyl N-[2-[4-(4-bromo-2-chlorophenoxy)butanoylamino]ethyl]carbamate |
| SMILES | COC(=O)NCCNC(=O)CCCOc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H18BrClN2O4/c1-21-14(20)18-7-6-17-13(19)3-2-8-22-12-5-4-10(15)9-11(12)16/h4-5,9H,2-3,6-8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | VMQYJWZZDDFDPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|