C15H17BrClN3O3 — CID 108537312
4-(4-bromo-2-chlorophenoxy)-N-[2-[(2-cyanoacetyl)amino]ethyl]butanamide (PubChem CID 108537312) has the molecular formula C15H17BrClN3O3 and a molecular weight of 402.68 g/mol. Its IUPAC name is 4-(4-bromo-2-chlorophenoxy)-N-[2-[(2-cyanoacetyl)amino]ethyl]butanamide.
| Compound Name | 4-(4-bromo-2-chlorophenoxy)-N-[2-[(2-cyanoacetyl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 108537312 |
| Molecular Formula | C15H17BrClN3O3 |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 4-(4-bromo-2-chlorophenoxy)-N-[2-[(2-cyanoacetyl)amino]ethyl]butanamide |
| SMILES | N#CCC(=O)NCCNC(=O)CCCOc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H17BrClN3O3/c16-11-3-4-13(12(17)10-11)23-9-1-2-14(21)19-7-8-20-15(22)5-6-18/h3-4,10H,1-2,5,7-9H2,(H,19,21)(H,20,22) |
| InChIKey | AOWFIKTVYUYZBR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|