C15H21BrClN3O4S — CID 108882634
N-[3-(4-bromo-2-chlorophenoxy)propyl]-4-methylsulfonylpiperazine-1-carboxamide (PubChem CID 108882634) has the molecular formula C15H21BrClN3O4S and a molecular weight of 454.77 g/mol. Its IUPAC name is N-[3-(4-bromo-2-chlorophenoxy)propyl]-4-methylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-[3-(4-bromo-2-chlorophenoxy)propyl]-4-methylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 108882634 |
| Molecular Formula | C15H21BrClN3O4S |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | N-[3-(4-bromo-2-chlorophenoxy)propyl]-4-methylsulfonylpiperazine-1-carboxamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)NCCCOc2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C15H21BrClN3O4S/c1-25(22,23)20-8-6-19(7-9-20)15(21)18-5-2-10-24-14-4-3-12(16)11-13(14)17/h3-4,11H,2,5-10H2,1H3,(H,18,21) |
| InChIKey | KJVBRUAFBUNVME-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|