C22H33N3O5 — CID 108532850
tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate (PubChem CID 108532850) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108532850 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl N-[2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-yl]-2-oxoethyl]carbamate |
| SMILES | Cc1ccc(OCCCC(=O)N2CCN(C(=O)CNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O5/c1-17-7-9-18(10-8-17)29-15-5-6-19(26)24-11-13-25(14-12-24)20(27)16-23-21(28)30-22(2,3)4/h7-10H,5-6,11-16H2,1-4H3,(H,23,28) |
| InChIKey | SJCPMEAPGMDHHA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|