C22H33N3O5 — CID 108548165
tert-butyl N-[2-oxo-2-[[1-(4-phenoxybutanoyl)piperidin-4-yl]amino]ethyl]carbamate (PubChem CID 108548165) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[[1-(4-phenoxybutanoyl)piperidin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[[1-(4-phenoxybutanoyl)piperidin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108548165 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[[1-(4-phenoxybutanoyl)piperidin-4-yl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NC1CCN(C(=O)CCCOc2ccccc2)CC1 |
| InChI | InChI=1S/C22H33N3O5/c1-22(2,3)30-21(28)23-16-19(26)24-17-11-13-25(14-12-17)20(27)10-7-15-29-18-8-5-4-6-9-18/h4-6,8-9,17H,7,10-16H2,1-3H3,(H,23,28)(H,24,26) |
| InChIKey | OZQYWRPMGKLVMR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|