C15H29N3O4 — CID 108537243
tert-butyl N-[3-[2-(2,2-dimethylpropanoylamino)ethylamino]-3-oxopropyl]carbamate (PubChem CID 108537243) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(2,2-dimethylpropanoylamino)ethylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(2,2-dimethylpropanoylamino)ethylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108537243 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | tert-butyl N-[3-[2-(2,2-dimethylpropanoylamino)ethylamino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H29N3O4/c1-14(2,3)12(20)17-10-9-16-11(19)7-8-18-13(21)22-15(4,5)6/h7-10H2,1-6H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | WTYZQMCSBSYYIP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|