C25H29N3O6 — CID 58280656
tert-butyl N-[3-oxo-3-[3-[(9-oxoxanthene-2-carbonyl)amino]propylamino]propyl]carbamate (PubChem CID 58280656) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[3-[(9-oxoxanthene-2-carbonyl)amino]propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[3-[(9-oxoxanthene-2-carbonyl)amino]propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 58280656 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[3-[(9-oxoxanthene-2-carbonyl)amino]propylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCCNC(=O)c1ccc2oc3ccccc3c(=O)c2c1 |
| InChI | InChI=1S/C25H29N3O6/c1-25(2,3)34-24(32)28-14-11-21(29)26-12-6-13-27-23(31)16-9-10-20-18(15-16)22(30)17-7-4-5-8-19(17)33-20/h4-5,7-10,15H,6,11-14H2,1-3H3,(H,26,29)(H,27,31)(H,28,32) |
| InChIKey | OSUBIACJDDTSJA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|