C13H16Cl2N2O2 — CID 108574747
N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3,4-dimethylbenzamide (PubChem CID 108574747) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 108574747 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)C(Cl)Cl)cc1C |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-8-3-4-10(7-9(8)2)12(18)16-5-6-17-13(19)11(14)15/h3-4,7,11H,5-6H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | MBZZOTRWQMKTQU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|