C14H9ClN2OS3 — CID 107808445
N-(4-carbamothioyl-2-chlorophenyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 107808445) has the molecular formula C14H9ClN2OS3 and a molecular weight of 352.89 g/mol. Its IUPAC name is N-(4-carbamothioyl-2-chlorophenyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(4-carbamothioyl-2-chlorophenyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 107808445 |
| Molecular Formula | C14H9ClN2OS3 |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | N-(4-carbamothioyl-2-chlorophenyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | NC(=S)c1ccc(NC(=O)c2cc3sccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C14H9ClN2OS3/c15-8-5-7(13(16)19)1-2-9(8)17-14(18)12-6-11-10(21-12)3-4-20-11/h1-6H,(H2,16,19)(H,17,18) |
| InChIKey | RIZWDQVOPIMWTR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|