C13H7Cl2NO2S2 — CID 107675579
N-(3,5-dichloro-2-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide (PubChem CID 107675579) has the molecular formula C13H7Cl2NO2S2 and a molecular weight of 344.24 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 107675579 |
| Molecular Formula | C13H7Cl2NO2S2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)thieno[3,2-b]thiophene-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1O)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H7Cl2NO2S2/c14-6-3-7(15)12(17)8(4-6)16-13(18)11-5-10-9(20-11)1-2-19-10/h1-5,17H,(H,16,18) |
| InChIKey | FJGAGDDDRCNDAL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|