C14H9NO4S2 — CID 80722230
5-hydroxy-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid (PubChem CID 80722230) has the molecular formula C14H9NO4S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-hydroxy-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid.
| Compound Name | 5-hydroxy-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 80722230 |
| Molecular Formula | C14H9NO4S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 5-hydroxy-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(O)cc1C(=O)O)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H9NO4S2/c16-7-1-2-9(8(5-7)14(18)19)15-13(17)12-6-11-10(21-12)3-4-20-11/h1-6,16H,(H,15,17)(H,18,19) |
| InChIKey | RLACTHMFJDMOFC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_F(2)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|