C14H8INO3S2 — CID 80723029
5-iodo-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid (PubChem CID 80723029) has the molecular formula C14H8INO3S2 and a molecular weight of 429.26 g/mol. Its IUPAC name is 5-iodo-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid.
| Compound Name | 5-iodo-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 80723029 |
| Molecular Formula | C14H8INO3S2 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.90 |
| IUPAC Name | 5-iodo-2-(thieno[3,2-b]thiophene-5-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(I)cc1C(=O)O)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H8INO3S2/c15-7-1-2-9(8(5-7)14(18)19)16-13(17)12-6-11-10(21-12)3-4-20-11/h1-6H,(H,16,17)(H,18,19) |
| InChIKey | BRIXDKCOWKFVKJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|